5-ISOPROPYL-2-METHOXYBENZENEBORONIC ACID
Reactant involved in the synthesis of many biologically active molecules including:• Oxazolidinones for use as cholesteryl ester transfer protein inhibitors for atherosclerosis treatment• Selective quinazolinyl-phenol inhibitors of CHK1 as antitumor and radioprotectants• Biaryl-containing carbamates as CETP inhibitors• α -Sulfone hydroxamates as MMP inhibitorsReactant involved in Suzuki-Miyaura cross coupling with 2-nitroarenediazonium tetrafluoroborate for synthesis of 2-nitrobiphenyls
| Supplier | BOC Sciences |
|---|---|
| Product # | 216393-63-4 |
| Pricing | Inquire |
| Cas | 216393-63-4 |
| Molecular Weight | 194.04 |
| Molecular Formula | C10H15BO3 |
| Canonical SMILES | B(C1=C(C=CC(=C1)C(C)C)OC)(O)O |