6-O-tert-butyldimethylsilyl-2,3-O-isopropylidene-L-gulonic acid γ-lactone
6-O-tert-butyldimethylsilyl-2,3-O-isopropylidene-L-gulonic acid γ-lactone is a valuable compound in biomedicine used for the treatment of various diseases. Its unique chemical structure allows it to effectively target and inhibit specific enzymes involved in pathogenic processes. This compound shows promising activity against viral infections and has also demonstrated potential in cancer therapy, showing selective toxicity towards tumor cells. Its versatile applications in the biomedical industry make it a valuable tool for drug discovery and development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 118464-47-4 |
| Pricing | Inquire |
| Cas | 118464-47-4 |
| Molecular Weight | 332.47 |
| Molecular Formula | C15H28O6Si |
| Canonical SMILES | CC1(OC2C(O1)C(=O)OC2C(CO[Si](C)(C)C(C)(C)C)O)C |