| Supplier |
Creative Peptides |
| Product # |
10-101-42 |
| CAS # |
1631754-28-3 |
| Pricing |
Inquire
|
| Synonyms |
Calcihexal; Calcimar; Forcaltonin; Fortical; Miacalcic; Miacalcin; Carbetocino; Carbetocinum; CID71715; EINECS 253-312-6; AC-3444; DB01282; I06-1830; AC3444; AC 3444; I06 1830
|
| MolecularFormula |
C47H73N11O14S
|
| MolecularWeight |
1048.21
|
| Sequence |
Three Letter Code: Butyryl-Tyr(Me)-Ile-Gln-Asn-Cys-Pro-Leu-Gly-NH2(Disulfide bond)
|
| Storage |
Desiccate at -20°C
|
| ShippingCondition |
Room temperature in continental US; may vary elsewhere.
|
| Explanation |
Carbetocin (trade name Duratocin) is an eight amino acid long analogue of oxytocin (a nonapeptide) with improved in vivo stability over oxytocin. Carbetocin primarily agonizes peripherally expressed oxytocin receptors.
|
| ChemicalName |
acetic acid;N-[1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]-1-[6-(2-amino-2-oxoethyl)-9-(3-amino-3-oxopropyl)-12-butan-2-yl-15-[(4-methoxyphenyl)methyl]-5,8,11,14,17-pentaoxo-1-thia-4,7,10,13,16-pentazacycloicosane-3-carbonyl]pyrrolidine-2-carboxamide
|
| Application |
Carbetocin is a drug used to control postpartum hemorrhage, bleeding after giving birth, since it causes contraction of the uterus.
|
| Activity |
Agonist
|
| InChI |
InChI=1S/C45H69N11O12S.C2H4O2/c1-6-25(4)38-44(66)51-28(15-16-34(46)57)40(62)52-31(21-35(47)58)41(63)54-32(23-69-18-8-10-37(60)50-30(42(64)55-38)20-26-11-13-27(68-5)14-12-26)45(67)56-17-7-9-33(56)43(65)53-29(19-24(2)3)39(61)49-22-36(48)59;1-2(3)4/h11-14,24-25,28-33,38H,6-10,15-23H2,1-5H3,(H2,46,57)(H2,47,58)(H2,48,59)(H,49,61)(H,50,60)(H,51,66)(H,52,62)(H,53,65)(H,54,63)(H,55,64);1H3,(H,3,4)
|
| InChIKey |
AWSBRHKQUFVWPU-UHFFFAOYSA-N
|
| CanonicalSMILES |
CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CSCCCC(=O)NC(C(=O)N1)CC2=CC=C(C=C2)OC)C(=O)N3CCCC3C(=O)NC(CC(C)C)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N.CC(=O)O
|
| BiologicalActivity |
Carbetocin acetate, an oxytocin (OT) analogue, is an oxytocin receptor agonist with a Ki of 7.1 nM. Carbetocin acetate has high affinity to chimeric N-terminus (E1) of the oxytocin receptor (Ki=1.17 μM). Carbetocin acetate has the potential for postpartum hemorrhage research. Carbetocin acetate can crosse the blood-brain barrier and produces antidepressant-like activity via activation of oxytocin receptors in the CNS.
|
| Target |
Oxytocin Receptor
|
| LongTermStorageConditions |
-20 °C
|