5'-Azido-2',5'-dideoxyuridine
5'-Azido-2',5'-dideoxyuridine is a biomedical compound used in antiretroviral therapy to specifically target and inhibit the replication of retroviruses, particularly HIV. With its azido group, it acting as a nucleoside analog, blocking the reverse transcriptase employed by the virus during synthesis of viral DNA.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35959-37-6 |
| Pricing | Inquire |
| Cas | 35959-37-6 |
| Molecular Weight | 253.21 |
| Molecular Formula | C9H11N5O4 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=O)NC2=O)CN=[N+]=[N-])O |