Anthelvencin B
It is produced by the strain of Streptomyces venezuelae. It has the activity of resisting gram positive bacterium, negative bacterium, mycobacterium, yeast and ringworm, has the inhibition to vaccinia virus, dysentery amoeba, and has the effect of repelling nematode in mice.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00479 |
| Pricing | Inquire |
| Cas | 11011-26-0 |
| Molecular Weight | 441.49 |
| Molecular Formula | C20H27N9O3 |
| Canonical SMILES | CN1C=C(C=C1C(=O)NC2=CN(C(=C2)C(=O)NCCC(=N)N)C)NC(=O)C3CCC(=N3)N |