6-Chloropurine riboside-5'-O-triphosphate
6-Chloropurine riboside-5'-O-triphosphate is a pivotal compound extensively employed in the biomedical sector for drug discovery and investigation, manifesting itself as a remarkably potent suppressor of specific enzymes, thus bestowing it with a noteworthy potential for research of diverse viral ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 55673-61-5 |
| Pricing | Inquire |
| Cas | 55673-61-5 |
| Molecular Weight | 526.6 |
| Molecular Formula | C10H14ClN4O13P3 |
| Canonical SMILES | C1=NC2=C(C(=N1)Cl)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |