5(6)-Carboxyeosin diacetate
5(6)-Carboxyeosin diacetate is an amine-reactive, green-fluorescent probe that is commonly used as a photosensitizer and photooxidizer. It is non-fluorescent until the acetate groups are cleaved by either enzymes or by alkali hydrolysis. 5(6)-Carboxyeosin diacetate may be reactive with amines on biomolecules such as peptides, proteins, modified nucleotides and biopolymers using a carbodiimide like EDAC or DIPC to yield a robust amide linkage.
| Supplier | BOC Sciences |
|---|---|
| Product # | 161338-87-0 |
| Pricing | Inquire |
| Cas | 161338-87-0 |
| Molecular Weight | 775.97 |
| Molecular Formula | C25H12Br4O9 |
| Canonical SMILES | CC(=O)OC1=C(C=C2C(=C1Br)OC3=C(C(=C(C=C3C24C5=C(C=C(C=C5)C(=O)O)C(=O)O4)Br)OC(=O)C)Br)Br.CC(=O)OC1=C(C=C2C(=C1Br)OC3=C(C(=C(C=C3C24C5=C(C=CC(=C5)C(=O)O)C(=O)O4)Br)OC(=O)C)Br)Br |