Coronarin D methyl ether
Coronarin D methyl ether, a natural titerpenoid isolated from the rhizomes of Hedychium coronarium, has inhibitory effects on the increase in vascular permeability, nitric oxide production, and inducible nitric oxide synthase induction.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1390 |
| Pricing | Inquire |
| Cas | 157528-81-9 |
| Molecular Weight | 332.5 |
| Molecular Formula | C21H32O3 |
| Canonical SMILES | CC1(CCCC2(C1CCC(=C)C2CC=C3CC(OC3=O)OC)C)C |