Fmoc-GGFG-PAB-OH
Fmoc-GGFG-PAB-OH is a peptide-based inhibitor that unveils its potential in contributing to the progression of biomedical research and therapeutic interventions. By selectively targeting key enzymes engaged in intricate cellular signaling pathways, this biomedical marvel showcases its prowess in thwarting diseases like cancer, autoimmune disorders, and inflammation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01456 |
| Pricing | Inquire |
| Cas | 2632341-89-8 |
| Molecular Weight | 586.68 |
| Molecular Formula | C33H38N4O6 |
| Canonical SMILES | O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NC(C(=O)NC(C(=O)NC(C(=O)NC4=CC=C(C=C4)CO)C)C(C)C)C |