S-Trityl-L-cysteine
S-Trityl-L-cysteine is a cell-permeable, potent and selective inhibitor of mitotic kinesin Eg5, a protein required for establishing and maintaining a bipolar spindle. S-Trityl-L-cysteine inhibits basal and microtubule-activated ATPase activity of Eg5 (IC50 = 1 mM and 140 nM, respectively). S-Trityl-L-cysteine was shown to induce mitotic arrest in HeLa cells with an IC50 of 700 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-008108 |
| Pricing | Inquire |
| Cas | 2799-07-7 |
| Molecular Weight | 363.47 |
| Molecular Formula | C22H21NO2S |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCC(C(=O)O)N |