FIIN-1
FIIN-1 is a potent, irreversible and selective FGFR inhibitor with IC50s of 9.2, 6.2, 11.9 and 189 nM against FGFR1/2/3/4, respectively. FIIN-1 binds to FGFR1/2/3/4 and Flt1/4 with Kds of 2.8, 6.9, 5.4, 120 nM and 32, 120 nM, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1256152-35-8 |
| Pricing | Inquire |
| Cas | 1256152-35-8 |
| Molecular Weight | 656.60 |
| Molecular Formula | C32H39Cl2N7O4 |
| Canonical SMILES | CCN(CC)CCCCNC1=NC=C2CN(C(=O)N(C2=N1)CC3=CC(=CC=C3)NC(=O)C=C)C4=C(C(=CC(=C4Cl)OC)OC)Cl |