Oganomycin A
Oganomycin A is produced by the strain of Str. oganonensis Y-G 19Z. It is more stable than cephalosporin and resistant to gram-positive and negative bacteria. And it is more effective against gram-negative bacteria than gram-positive bacteria.
Supplier | BOC Sciences |
---|---|
Product # | BBF-02146 |
Pricing | Inquire |
Cas | 75794-94-4 |
Molecular Weight | 629.61 |
Molecular Formula | C24H27N3O13S2 |
Canonical SMILES | COC1(C2N(C1=O)C(=C(CS2)COC(=O)C=CC3=CC=C(C=C3)OS(=O)(=O)O)C(=O)O)NC(=O)CCCC(C(=O)O)N |