Lithocholic acid
Lithocholic acid is a toxic secondary bile acid, causes intrahepatic cholestasis, has tumor-promoting activity, its toxic effect can be protected after it activates the vitamin D receptor, PXR and FXR.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6107 |
| Pricing | Inquire |
| Cas | 434-13-9 |
| Molecular Weight | 376.58 |
| Molecular Formula | C24H40O3 |
| Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C |