Galloflavin Potassium salt
Galloflavin Potassium salt is an inhibitor of human lactate dehydrogenase (LDH) (Ki = 5.46 and 15.1 μM for LDH-A and LDH-B, respectively, in competition with pyruvate) with anticancer activity. Galloflavin inhibits lactate production and decreases ATP synthesis in PLD/PRF/5 cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1780260-20-9 |
| Pricing | Inquire |
| Cas | 1780260-20-9 |
| Molecular Weight | 316.26 |
| Molecular Formula | C12H5O8K |
| Canonical SMILES | C1=C2C(=C(C(=C1O)O)O)C3=C(C=C(C(=O)O3)[O-])OC2=O.[K+] |