3'-Azido-3'-deoxy-5-fluorocytidine
3'-Azido-3'-deoxy-5-fluorocytidine is an innovative compound extensively used in the biomedical industry. It acts as a potent antiviral medication, primarily used in the treatment of HIV/AIDS. This product suppresses viral replication by inhibiting reverse transcriptase, a crucial enzyme involved in the viral life cycle. Its high specificity and effectiveness make it a valuable tool in the fight against HIV/AIDS.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-18-6 |
| Pricing | Inquire |
| Cas | 2095417-18-6 |
| Molecular Weight | 286.22 |
| Molecular Formula | C9H11FN6O4 |
| Canonical SMILES | C1=C(C(=NC(=O)N1C2C(C(C(O2)CO)N=[N+]=[N-])O)N)F |