N-Acetyl-α-D-glucosamine-1-phosphate disodium salt
N-Acetyl-α-D-glucosamine-1-phosphate disodium salt is an indispensable compound in the biomedical sector with applications extending to studying an array of diseases and conditions, including particular enzyme deficiencies and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-369865 |
| Pricing | Inquire |
| Cas | 31281-59-1 |
| Molecular Weight | 345.15 |
| Molecular Formula | C8H14NNa2O9P |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OP(=O)([O-])[O-])CO)O)O.[Na+].[Na+] |