3'-beta-C-Methylguanosine
3'-beta-C-Methylguanosine, a paramount compound in the realm of biomedicine, assumes a pivotal position. It not only serves as an active participant in the realm of antiviral therapeutics but also showcases promise as a prospective intervention against infectious ailments inflicted by RNA viruses. Its exceptional proficiency lies in its capacity to obstruct viral replication and RNA synthesis, which in turn manifests as an effective antiviral agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 115303-89-4 |
| Pricing | Inquire |
| Cas | 115303-89-4 |
| Molecular Weight | 297.27 |
| Molecular Formula | C11H15N5O5 |
| Canonical SMILES | CC1(C(OC(C1O)N2C=NC3=C2N=C(NC3=O)N)CO)O |