4-(1-Naphthyl)-3-buten-2-one
The chemical compound, 4-(1-Naphthyl)-3-buten-2-one, serves as a vital ingredient in the synthesis of numerous pharmaceuticals. Its potential as a tumor cell growth inhibitor has garnered significant attention, and researchers are currently exploring its viability as a prospective cancer treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0001-264494 |
| Pricing | Inquire |
| Cas | 66920-75-0 |
| Molecular Weight | 196.24 |
| Molecular Formula | C14H12O |
| Canonical SMILES | CC(=O)C=CC1=CC=CC2=CC=CC=C21 |