Spirostan-3-ol
Spirostan-3-ol is a potent and naturally occurring compound, abundantly existing within diverse botanical species. Its emergence in the biomedical field is highly promising due to its efficacious capacity to impede specific enzyme pathways implicated in malignant disease advancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 82597-74-8 |
| Pricing | Inquire |
| Cas | 82597-74-8 |
| Molecular Weight | 416.64 |
| Molecular Formula | C27H44O3 |
| Canonical SMILES | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)OC1 |