2,2'-Bis(diphenylphosphino)-1,1'-biphenyl
2,2'-Bis(diphenylphosphino)-1,1'-biphenyl, also known as BINAP, is a chiral ligand used extensively in asymmetric synthesis in the pharmaceutical industry. It aids chemical reactions, especially the creation of certain anti-cancer drugs, anti-fungal medications, and cardiovascular drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84783-64-2 |
| Pricing | Inquire |
| Cas | 84783-64-2 |
| Molecular Weight | 522.56 |
| Molecular Formula | C36H28P2 |
| Canonical SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3C4=CC=CC=C4P(C5=CC=CC=C5)C6=CC=CC=C6 |