N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-Amphotericin B
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-Amphotericin B is an intermediate in the synthesis of Amphoteronolide B (A634910), a glycon form of Amphotericin B (A634250) which are polyene macrolide antibiotics. It is also an intermediate in the synthesis of 13-O-Ethylamphotericin B (E899350), an analogue of 13-O-Methylamphotericin B (M287440), which is a derivative of Amphotericin B and an antifungal.
Supplier | BOC Sciences |
---|---|
Product # | BB064617 |
Pricing | Inquire |
Cas | 127970-81-4 |
Molecular Weight | 1146.33 |
Molecular Formula | C62H83NO19 |
Canonical SMILES | CC1C=CC=CC=CC=CC=CC=CC=CC(CC2C(C(CC(O2)(CC(CC(C(CCC(CC(CC(=O)OC(C(C1O)C)C)O)O)O)O)O)O)O)C(=O)O)OC3C(C(C(C(O3)C)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46)O |