Ampicillin-[d5] (Mixture of Diastereomers)
Ampicillin-[d5] (Mixture of Diastereomers) is the labelled analogue of Ampicillin. Ampicillin is a penicillin antibiotic that is used to treat or prevent many different types of infections such as bladder infections, pneumonia, gonorrhea, meningitis, or infections of the stomach or intestines.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011537 |
| Pricing | Inquire |
| Cas | 1426173-65-0 |
| Molecular Weight | 354.44 |
| Molecular Formula | C16H14D5N3O4S |
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)O)C |