D-Glucose-6-phosphate
D-Glucose-6-phosphate - the cornerstone of metabolic pathways! In glycolysis, this master of interconversion transforms into glucose-1-phosphate under the watchful eye of phosphoglucomutase. But this is only the beginning. Its importance extends to vital glycogen synthesis and the catalysis of NADPH production - essential for various biosynthetic reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 56-73-5 |
| Pricing | Inquire |
| Cas | 56-73-5 |
| Molecular Weight | 260.14 |
| Molecular Formula | C6H13O9P |
| Canonical SMILES | C(C(C(C(C(C=O)O)O)O)O)OP(=O)(O)O |