(3-Carboxypropyl)triphenylphosphonium Bromide
(3-Carboxypropyl)triphenylphosphonium Bromide is a reagent used for the preparation of sphingosine 1-phosphate-1 receptor antagonists, as well as for the synthesis of mitochondrial vitamin E metabolites and other mitochondrial targets in the study of mitochodrial functions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17857-14-6 |
| Pricing | Inquire |
| Cas | 17857-14-6 |
| Molecular Weight | 429.29 |
| Molecular Formula | C22H22BrO2P |
| Canonical SMILES | C1=CC=C(C=C1)[P+](CCCC(=O)O)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |