3'-O-(2-Methoxyethyl)-5-methyluridine
3'-O-(2-Methoxyethyl)-5-methyluridine plays a crucial role in various drug formulations targeting diseases like cancer, viral infections, and genetic disorders. With its unique chemical properties, it enhances drug stability and efficacy, allowing for precise targeted therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 303197-29-7 |
| Pricing | Inquire |
| Cas | 303197-29-7 |
| Molecular Weight | 316.31 |
| Molecular Formula | C13H20N2O7 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)OCCOC)O |