Araguspongin B
Araguspongin B is a compound isolated from Pacific basin sponges. It shows notable vasodilatory properties. Araguspongin B antagonizes the calcium-releasing action of inositol 1,4,5-trisphosphate at the receptor level with an IC50 value of 0.6 µM in cerebral microsomes. It is nearly as potent as xestospongin C as an antagonist of the IP3 receptor.
| Supplier | BOC Sciences |
|---|---|
| Product # | 123000-02-2 |
| Pricing | Inquire |
| Cas | 123000-02-2 |
| Molecular Weight | 446.7 |
| Molecular Formula | C28H50N2O2 |
| Canonical SMILES | C1CCC[C@H]2CCCN3CC[C@H](CCCCCC[C@H]4CCCN5CC[C@@H](CC1)O[C@H]45)O[C@H]23 |