4'-Deoxybutirosin A
4'-Deoxybutirosin A is an antibiotic produced by Bacillus circulans, B. biotinicus, and B. proteophilus. It has strong inhibition of Escherichia coli and pneumoniae bacteria, and is clinically used for intestinal disinfection before surgery.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03261 |
| Pricing | Inquire |
| Cas | 52760-38-0 |
| Molecular Weight | 539.58 |
| Molecular Formula | C21H41N5O11 |
| Canonical SMILES | C1C(OC(C(C1O)N)OC2C(CC(C(C2OC3C(C(C(O3)CO)O)O)O)NC(=O)C(CCN)O)N)CN |