2-Bromo-5-methoxybenzoic acid
2-Bromo-5-methoxybenzoic acid (CAS# 22921-68-2) is an intermediate in the synthesis of more complex pharmaceutical and biologically active compounds. It is used in the synthesis of benzylisothioureas as potent divalent metal transporter 1 (DMT1) inhibitors.
Supplier | BOC Sciences |
---|---|
Product # | 22921-68-2 |
Pricing | Inquire |
Cas | 22921-68-2 |
Molecular Weight | 231.04 |
Molecular Formula | C8H7BrO3 |
Canonical SMILES | COC1=CC(=C(C=C1)Br)C(=O)O |