4-Methylumbelliferyl 4-O-(a-L-fucopyranosyl)-b-D-galactopyranoside
4-Methylumbelliferyl 4-O-(a-L-fucopyranosyl)-b-D-galactopyranoside is a valuable tool in biomedicine, commonly used to study the activity of α-L-fucosidase enzymes. This compound can be hydrolyzed by α-L-fucosidase to release 4-methylumbelliferone, a fluorescent compound.
| Supplier | BOC Sciences |
|---|---|
| Product # | 383160-15-4 |
| Pricing | Inquire |
| Cas | 383160-15-4 |
| Molecular Weight | 484.45 |
| Molecular Formula | C22H28O12 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3=CC4=C(C=C3)C(=CC(=O)O4)C)CO)O)O)O |