N3-Tetrahydrofurfuryluridine
N3-Tetrahydrofurfuryluridine, an eminent biomedical product, reigns as a pivotal therapeutic intervention against an array of malignancies and pernicious viral afflictions. Representing a nucleoside analog, it exerts its pharmacological influence by disrupting viral genome amplification, thereby sabotaging the vital cascade of viral nucleotide synthesis. In addition to its efficacy as an antiviral combatant, this compound stands as a promising candidate for pioneering research aimed at fortifying the pharmacotherapy of viral infections through the expedient development of avant-garde antiviral agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 122666-26-6 |
| Pricing | Inquire |
| Cas | 122666-26-6 |
| Molecular Weight | 328.32 |
| Molecular Formula | C14H20N2O7 |
| Canonical SMILES | C1CC(OC1)CN2C(=O)C=CN(C2=O)C3C(C(C(O3)CO)O)O |