Ellagic acid
| Supplier | CD Formulation |
|---|---|
| Product # | CDC10-0049 |
| CAS # | 207-508-3 |
| Pricing | , Inquire for price |
| product1 | Cosmetic Ingredients |
| Molecular Formula | C14H6O8•xH2O |
| Synonyms | 4,4′,5,5′,6,6′-Hexahydroxydiphenic acid 2,6,2′,6′-dilactone, Alizarin Yellow, Benzoaric acid, Elagostasine, Eleagic acid, Gallogen, Lagistase |
| CAS Number | 476-66-4 |
| Category | Antioxidant Cosmetic Chemicals |
| Purity | ≥95% (HPLC) |
| Color | Tan to gray |
| Physical State | Powder |
| Solubility | 1 M NaOH: 10 mg/mL |
| Quality Level | 200.0 |
| Storage | 2-8°C |
| Boiling Point | 363.24°C (rough estimate) |
| Melting Point | ≥350 °C |
| Density | 1.667 g/mL |
| Molecular Weight (g/mol) | 302.19 |
| MDL number | MFCD00006914 |
| NACRES | NA.77 |
| Refractive Index | 1.5800 (estimate) |
| InChI Key | AFSDNFLWKVMVRB-UHFFFAOYSA-N |
| SMILES | Oc1cc2C(=O)Oc3c(O)c(O)cc4C(=O)Oc(c1O)c2-c34 |
| InChI | 1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Hazard Codes | Xi |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3.0 |
| RTECS | DJ2620000 |
| HS Code | 29322090.0 |
| Water Solubility | <0.1 g/100 mL at 21 ºC |
| Image | 476-66-4 |