Moxonidine-[d4]
Moxonidine-[d4] is the labelled analogue of Moxonidine. Moxonidine is a selective agonist at the imidazoline receptor subtype (I1). It binds with much greater affinity to the imidazoline I1-receptor than to the α2-receptor while clonidine binds to both receptors with equal affinity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012465 |
| Pricing | Inquire |
| Cas | 1794811-52-1 |
| Molecular Weight | 245.7 |
| Molecular Formula | C9H8D4ClN5O |
| Canonical SMILES | CC1=NC(=C(C(=N1)Cl)NC2=NCCN2)OC |