Methyl 2-acetamido-4,6-di-O-acetyl-2,3-dideoxy-3-fluoro-α-D-mannopyranoside
Methyl 2-acetamido-4,6-di-O-acetyl-2,3-dideoxy-3-fluoro-α-D-mannopyranoside, a fascinating compound hailing from the biomedical industry, has garnered attention for its prospective contribution in the realm of drug development. Its remarkable properties enable it to target precise receptors or enzymes involved in the pathogenesis of distinct ailments, offering potential therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 149513-97-3 |
| Pricing | Inquire |
| Cas | 149513-97-3 |
| Molecular Weight | 321.30 |
| Molecular Formula | C13H20FNO7 |
| Canonical SMILES | O=C(OCC1OC(OC)C(NC(=O)C)C(F)C1OC(=O)C)C |