Bacithrocin B
Bacithrocin B is produced by the strain of Bacillus laterosporus Laubach NR 2988. The ED50 of the four components A, B, C and D were 48, 84, 80, 124X10-6 mol/L, and the reference antipain was 13X10-6 mol/L, respectively.
Supplier | BOC Sciences |
---|---|
Product # | BBF-00252 |
Pricing | Inquire |
Molecular Weight | 375.46 |
Molecular Formula | C19H29N5O3 |
Canonical SMILES | CC(C)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCCN=C(N)N)C=O |