18:1 MPB PE (sodium salt)
Recognized for its integral role in facilitating drug delivery within the biomedical sphere, 18:1 MPB PE (sodium salt) emerges as a critical phospholipid. Employed in liposomes for gene therapy, it unveils its versatile nature. Its significance resonates in diverse research domains, spanning from cancer to neurodegenerative afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 384835-49-8 |
| Pricing | Inquire |
| Cas | 384835-49-8 |
| Molecular Weight | 1007.26 |
| Molecular Formula | C55H88N2O11PNa |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCCNC(=O)CCCC1=CC=C(C=C1)N2C(=O)C=CC2=O)OC(=O)CCCCCCCC=CCCCCCCCC.[Na+] |