6-O-(2-Acetamido-2-deoxy-b-D-glucopyranosyl)-D-galactopyranose
6-O-(2-Acetamido-2-deoxy-b-D-glucopyranosyl)-D-galactopyranose is a vital compound used in the biomedical industry. It is primarily utilized in pharmaceutical research to develop drugs targeting specific diseases related to carbohydrate metabolism, such as diabetes or glycogen storage diseases. This compound plays a crucial role in understanding and potentially studying these conditions by modulating glucose metabolism and glycosylation pathways.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20212-77-5 |
| Pricing | Inquire |
| Cas | 20212-77-5 |
| Molecular Weight | 383.36 |
| Molecular Formula | C14H25NO11 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OCC2C(C(C(C(O2)O)O)O)O)CO)O)O |