Lalistat 1
Lalistat 1 is a lysosomal acid lipase inhibitor with IC50 value of 68 nM. It can block LAL-mediated lipid hydrolysis of acetylated LDL and reduce efflux of cholesterol from lipid-loaded cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 501104-16-1 |
| Pricing | Inquire |
| Cas | 501104-16-1 |
| Molecular Weight | 298.36 |
| Molecular Formula | C12H18N4O3S |
| Canonical SMILES | C1CCN(CC1)C2=NSN=C2OC(=O)N3CCOCC3 |