Isodeoxycholic acid
Isodeoxycholic acid is a bile acid that is formed via epimerization of deoxycholic acid by intestinal bacteria. Isodeoxycholic Acid is used for comprehensive bile acid profiling in hereditary intrahepatic cholestasis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 566-17-6 |
| Pricing | Inquire |
| Cas | 566-17-6 |
| Molecular Weight | 392.57 |
| Molecular Formula | C24H40O4 |
| Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCCC4)C)O)O)C |