10-methyl-9-(phenoxycarbonyl) Acridinium trifluoromethylsulfonate
10-methyl-9-(phenoxycarbonyl) Acridinium produces fluorescent compound 10-methyl-9-acridone upon oxidation with hydrogen peroxide, persulfates, and other oxidants in alkaline conditions. It has been used in chemiluminescence assays, enzyme, antigen, antibody, and hormone immunoassays.
| Supplier | BOC Sciences |
|---|---|
| Product # | 161006-14-0 |
| Pricing | Inquire |
| Cas | 161006-14-0 |
| Molecular Weight | 463.4 |
| Molecular Formula | C21H16NO2·CF3O3S |
| Canonical SMILES | C[N+]1=C2C=CC=CC2=C(C3=CC=CC=C31)C(=O)OC4=CC=CC=C4.C(F)(F)(F)S(=O)(=O)[O-] |