Phenolphthalein b-D-glucuronic acid sodium salt
Phenolphthalein b-D-glucuronic acid sodium salt is a widely employed biomedical product for research functioning as a substrate to discern β-glucuronidase activity. It significantly aids in studying drugs and diseases, encompassing cancer, hepatitis and urinary tract infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15265-26-6 |
| Pricing | Inquire |
| Cas | 15265-26-6 |
| Molecular Weight | 517.44 |
| Molecular Formula | C26H22O10Na |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)OC5C(C(C(C(O5)C(=O)O)O)O)O |