9-Ribofuranosyl-9H-Purine-6-thiol
9-Ribofuranosyl-9H-Purine-6-thiol, utilized as an antiviral therapy to hinder viral replication, has been demonstrated to treat viral infections including, but not limited to, Hepatitis B and HIV. Its selectivity enables the targeted impact on infected CD4 T-helper cells, subsequently leading to a decrease of the viral load while simultaneously heightening the CD4 cell count.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4988-64-1 |
| Pricing | Inquire |
| Cas | 4988-64-1 |
| Molecular Weight | 284.29 |
| Molecular Formula | C10H12N4O4S |
| Canonical SMILES | C1=NC(=S)C2=C(N1)N(C=N2)C3C(C(C(O3)CO)O)O |