2,3-Isopropylidene ribavirin
2,3-Isopropylidene ribavirin, an exceedingly potent antiviral agent, serves as a crucial therapeutic solution for the management of hepatitis C virus (HCV) infection. With its robust inhibitory prowess exhibited against HCV RNA-dependent RNA polymerase, it remarkably curtails viral replication.
Supplier | BOC Sciences |
---|---|
Product # | 52663-90-8 |
Pricing | Inquire |
Cas | 52663-90-8 |
Molecular Weight | 284.27 |
Molecular Formula | C11H16N4O5 |
Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=NC(=N3)C(=O)N)CO)C |