2,3-Isopropylidene ribavirin
2,3-Isopropylidene ribavirin, an exceedingly potent antiviral agent, serves as a crucial therapeutic solution for the management of hepatitis C virus (HCV) infection. With its robust inhibitory prowess exhibited against HCV RNA-dependent RNA polymerase, it remarkably curtails viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52663-90-8 |
| Pricing | Inquire |
| Cas | 52663-90-8 |
| Molecular Weight | 284.27 |
| Molecular Formula | C11H16N4O5 |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=NC(=N3)C(=O)N)CO)C |