18:1 Biotinyl Cap PE (sodium salt)
18:1 Biotinyl Cap PE (sodium salt) displays efficacy within the biomedical field, notably serving as a pivotal component within drug delivery mechanisms. Its capabilities extend to the precise targeting of specific cellular entities, proving beneficial in the management of diverse health conditions such as cancer and neurological ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 384835-51-2 |
| Pricing | Inquire |
| Cas | 384835-51-2 |
| Molecular Weight | 1105.47 |
| Molecular Formula | C57H102N4O11PNaS |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCCNC(=O)CCCCCNC(=O)CCCCC1C2C(CS1)NC(=O)N2)OC(=O)CCCCCCCC=CCCCCCCCC.[Na+] |