4-O-Acetyl-2,5-anhydro-1,3-O-isopropylidene-6-[bis(2-cyanoethyl)phosphoryl]-D-glucitol
4-O-Acetyl-2,5-anhydro-1,3-O-isopropylidene-6-[bis(2-cyanoethyl)phosphoryl]-D-glucitol, an extensively explored compound in biomedicine, exhibits remarkable promise for therapeutic interventions.The intricate molecular architecture and distinctive properties of this compound contribute significantly to its value as an indispensable constituent in biomedical research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1041021-85-5 |
| Pricing | Inquire |
| Cas | 1041021-85-5 |
| Molecular Weight | 432.36 |
| Molecular Formula | C17H25N2O9P |
| Canonical SMILES | CC(=O)OC1C(OC2C1OC(OC2)(C)C)COP(=O)(OCCC#N)OCCC#N |