3'-O-Acetyl-5'-O-DMT-5-iodo-2'-O-methyl-uridine
Highly specialized in the field of biomedicine, 3'-O-Acetyl-5'-O-DMT-5-iodo-2'-O-methyl-uridine stands as a critical compound. Its employment primarily revolves around synthesizing nucleotide analogs for antiviral drug development and acting as a probe in biochemical studies concerning RNA. Promising therapeutic applications against viral infections, like HIV and hepatitis B, are attributed to this product.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1374692-34-8 |
| Pricing | Inquire |
| Cas | 1374692-34-8 |
| Molecular Weight | 728.53 |
| Molecular Formula | C33H33IN2O9 |
| Canonical SMILES | CC(=O)OC1C(OC(C1OC)N2C=C(C(=O)NC2=O)I)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |