5-Hydroxytoluene-2,4-disulfonic acid
5-Hydroxytoluene-2,4-disulfonic acid, a chemical compound extensively utilized in the pharmaceutical sector as an intermediary for the synthesis of several drugs, comprising dapsone and sulfoxone, attracts increasing interest due to its prospective employment as an antioxidant in cosmetic and food applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-132126 |
| Pricing | Inquire |
| Cas | 15509-33-8 |
| Molecular Weight | 268.3 |
| Molecular Formula | C7H8O7S2 |
| Canonical SMILES | CC1=CC(=C(C=C1S(=O)(=O)O)S(=O)(=O)O)O |