(3S) -3-[[(1,1-Dimethylethoxy) carbonyl] amino] -4-hydroxy-butanoic Acid Methyl Ester
(3S) -3-[[(1,1-Dimethylethoxy) carbonyl] amino] -4-hydroxy-butanoic Acid Methyl Ester is used to prepare CCR3 antagonists with picomolar inhibition potency against eosinophil chemotaxis. It is also used to synthesize aryl substituted, β- and γ-amino acids in DMF using functionalized zinc reagents.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB067076 |
| Pricing | Inquire |
| Cas | 136703-59-8 |
| Molecular Weight | 233.26 |
| Molecular Formula | C10H19NO5 |
| Canonical SMILES | CC(C)(C)OC(=O)NC(CC(=O)OC)CO |