2,3-O-Isopropylidene-b-D-ribofuranosylamine p-toluenesulphonate salt
2,3-O-Isopropylidene-b-D-ribofuranosylamine p-toluenesulphonate salt is a specialized reagent commonly used in the synthesis of nucleoside analogs, which are integral to a variety of antiviral and anticancer drugs. It promotes efficient bond formation between complex molecules.
| Supplier | BOC Sciences |
|---|---|
| Product # | 29836-10-0 |
| Pricing | Inquire |
| Cas | 29836-10-0 |
| Molecular Weight | 361.41 |
| Molecular Formula | C15H23NO7S |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1(OC2C(OC(C2O1)N)CO)C |