2'-Hydroxy-3-phenylpropiophenone-[d5]
2'-Hydroxy-3-phenylpropiophenone-[d5], is the labelled analogue of 2'-Hydroxy-3-phenylpropiophenone, which is a metabolite of Propafenone. Propafenone is a class 1C anti-arrhythmic medication, which treats illnesses associated with rapid heart beats such as atrial and ventricular arrhythmias.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-001998 |
| Pricing | Inquire |
| Cas | 1346601-26-0 |
| Molecular Weight | 231.3 |
| Molecular Formula | C15H9D5O2 |
| Canonical SMILES | C1=CC=C(C=C1)CCC(=O)C2=CC=CC=C2O |