Cyclic-HPMPC
Cyclic HPMPC is a potent antiviral agent. Cyclic HPMPC can increase arterial oxygen saturation levels in lethal vaccinia virus (IHD strain)-infected mice. Cyclic HPMPC improves the outcome of congenital guinea pig cytomegalovirus (GPCMV) infection and decreases viral replication in guinea pig model.
| Supplier | BOC Sciences |
|---|---|
| Product # | 127757-45-3 |
| Pricing | Inquire |
| Cas | 127757-45-3 |
| Molecular Weight | 261.17 |
| Molecular Formula | C8H12N3O5P |
| Canonical SMILES | C1C(OCP(=O)(O1)O)CN2C=CC(=NC2=O)N |